C15H15ClN2O3S — CID 96547534
5-chloro-N-[(3S)-1,1-dioxothian-3-yl]quinoline-8-carboxamide (PubChem CID 96547534) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is 5-chloro-N-[(3S)-1,1-dioxothian-3-yl]quinoline-8-carboxamide.
| Compound Name | 5-chloro-N-[(3S)-1,1-dioxothian-3-yl]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 96547534 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 5-chloro-N-[(3S)-1,1-dioxothian-3-yl]quinoline-8-carboxamide |
| SMILES | O=C(N[C@H]1CCCS(=O)(=O)C1)c1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C15H15ClN2O3S/c16-13-6-5-12(14-11(13)4-1-7-17-14)15(19)18-10-3-2-8-22(20,21)9-10/h1,4-7,10H,2-3,8-9H2,(H,18,19)/t10-/m0/s1 |
| InChIKey | CNRWDNJHOWRHMM-JTQLQIEISA-N |
| XLogP | 2.20 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |