C12H17N3O3S — CID 63918472
N-(1,1-dioxothian-3-yl)-2-(methylamino)pyridine-3-carboxamide (PubChem CID 63918472) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-2-(methylamino)pyridine-3-carboxamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-2-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 63918472 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-2-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ncccc1C(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17N3O3S/c1-13-11-10(5-2-6-14-11)12(16)15-9-4-3-7-19(17,18)8-9/h2,5-6,9H,3-4,7-8H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | UQECAEIVINMKKN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |