C14H19N3O3S — CID 104615050
N-(1,1-dioxothian-3-yl)-1,2,3,4-tetrahydroquinoxaline-5-carboxamide (PubChem CID 104615050) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-1,2,3,4-tetrahydroquinoxaline-5-carboxamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-1,2,3,4-tetrahydroquinoxaline-5-carboxamide |
|---|---|
| PubChem CID | 104615050 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-1,2,3,4-tetrahydroquinoxaline-5-carboxamide |
| SMILES | O=C(NC1CCCS(=O)(=O)C1)c1cccc2c1NCCN2 |
| InChI | InChI=1S/C14H19N3O3S/c18-14(17-10-3-2-8-21(19,20)9-10)11-4-1-5-12-13(11)16-7-6-15-12/h1,4-5,10,15-16H,2-3,6-9H2,(H,17,18) |
| InChIKey | GWSRBESBIQPFLG-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |