C12H13Br2NO3S — CID 114372378
2,5-dibromo-N-(1,1-dioxothian-3-yl)benzamide (PubChem CID 114372378) has the molecular formula C12H13Br2NO3S and a molecular weight of 411.12 g/mol. Its IUPAC name is 2,5-dibromo-N-(1,1-dioxothian-3-yl)benzamide.
| Compound Name | 2,5-dibromo-N-(1,1-dioxothian-3-yl)benzamide |
|---|---|
| PubChem CID | 114372378 |
| Molecular Formula | C12H13Br2NO3S |
| Molecular Weight | 411.12 g/mol |
| Exact Mass | 408.90 |
| IUPAC Name | 2,5-dibromo-N-(1,1-dioxothian-3-yl)benzamide |
| SMILES | O=C(NC1CCCS(=O)(=O)C1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H13Br2NO3S/c13-8-3-4-11(14)10(6-8)12(16)15-9-2-1-5-19(17,18)7-9/h3-4,6,9H,1-2,5,7H2,(H,15,16) |
| InChIKey | CWEVJALJLPWWEC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.12 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |