C13H14N2O3S — CID 63922155
3-cyano-N-(1,1-dioxothian-3-yl)benzamide (PubChem CID 63922155) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-cyano-N-(1,1-dioxothian-3-yl)benzamide.
| Compound Name | 3-cyano-N-(1,1-dioxothian-3-yl)benzamide |
|---|---|
| PubChem CID | 63922155 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-cyano-N-(1,1-dioxothian-3-yl)benzamide |
| SMILES | N#Cc1cccc(C(=O)NC2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H14N2O3S/c14-8-10-3-1-4-11(7-10)13(16)15-12-5-2-6-19(17,18)9-12/h1,3-4,7,12H,2,5-6,9H2,(H,15,16) |
| InChIKey | XROGDBBVSLOLNR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |