C15H16N2O3S — CID 97359258
(Z)-3-(3-cyanophenyl)-N-[(3R)-1,1-dioxothian-3-yl]prop-2-enamide (PubChem CID 97359258) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is (Z)-3-(3-cyanophenyl)-N-[(3R)-1,1-dioxothian-3-yl]prop-2-enamide.
| Compound Name | (Z)-3-(3-cyanophenyl)-N-[(3R)-1,1-dioxothian-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 97359258 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (Z)-3-(3-cyanophenyl)-N-[(3R)-1,1-dioxothian-3-yl]prop-2-enamide |
| SMILES | N#Cc1cccc(/C=C\C(=O)N[C@@H]2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C15H16N2O3S/c16-10-13-4-1-3-12(9-13)6-7-15(18)17-14-5-2-8-21(19,20)11-14/h1,3-4,6-7,9,14H,2,5,8,11H2,(H,17,18)/b7-6-/t14-/m1/s1 |
| InChIKey | NVIXHNHFGLKINR-LMVHVUTASA-N |
| XLogP | 1.26 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|