C17H20N2O — CID 115880739
(E)-3-(3-cyanophenyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide (PubChem CID 115880739) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (E)-3-(3-cyanophenyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide.
| Compound Name | (E)-3-(3-cyanophenyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide |
|---|---|
| PubChem CID | 115880739 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (E)-3-(3-cyanophenyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide |
| SMILES | CC1(C)CCC(NC(=O)/C=C/c2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C17H20N2O/c1-17(2)9-8-15(11-17)19-16(20)7-6-13-4-3-5-14(10-13)12-18/h3-7,10,15H,8-9,11H2,1-2H3,(H,19,20)/b7-6+ |
| InChIKey | LNZUHUASSFDOCG-VOTSOKGWSA-N |
| XLogP | 3.27 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|