C16H20BrNO — CID 114550381
(E)-3-(4-bromophenyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide (PubChem CID 114550381) has the molecular formula C16H20BrNO and a molecular weight of 322.25 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide |
|---|---|
| PubChem CID | 114550381 |
| Molecular Formula | C16H20BrNO |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-(3,3-dimethylcyclopentyl)prop-2-enamide |
| SMILES | CC1(C)CCC(NC(=O)/C=C/c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C16H20BrNO/c1-16(2)10-9-14(11-16)18-15(19)8-5-12-3-6-13(17)7-4-12/h3-8,14H,9-11H2,1-2H3,(H,18,19)/b8-5+ |
| InChIKey | MASGVKVLXXCEIT-VMPITWQZSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|