C17H24BrNO — CID 114550396
3-(4-bromophenyl)-N-(3,3-dimethylcyclopentyl)butanamide (PubChem CID 114550396) has the molecular formula C17H24BrNO and a molecular weight of 338.29 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(3,3-dimethylcyclopentyl)butanamide.
| Compound Name | 3-(4-bromophenyl)-N-(3,3-dimethylcyclopentyl)butanamide |
|---|---|
| PubChem CID | 114550396 |
| Molecular Formula | C17H24BrNO |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-(4-bromophenyl)-N-(3,3-dimethylcyclopentyl)butanamide |
| SMILES | CC(CC(=O)NC1CCC(C)(C)C1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H24BrNO/c1-12(13-4-6-14(18)7-5-13)10-16(20)19-15-8-9-17(2,3)11-15/h4-7,12,15H,8-11H2,1-3H3,(H,19,20) |
| InChIKey | IDVWRQUPXXLERC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |