C12H12BrNO — CID 903325
(E)-3-(4-bromophenyl)-N-cyclopropylprop-2-enamide (PubChem CID 903325) has the molecular formula C12H12BrNO and a molecular weight of 266.14 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-cyclopropylprop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-cyclopropylprop-2-enamide |
|---|---|
| PubChem CID | 903325 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-cyclopropylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)NC1CC1 |
| InChI | InChI=1S/C12H12BrNO/c13-10-4-1-9(2-5-10)3-8-12(15)14-11-6-7-11/h1-5,8,11H,6-7H2,(H,14,15)/b8-3+ |
| InChIKey | YMASMQJPFXADOY-FPYGCLRLSA-N |
| XLogP | 2.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|