C13H14BrNO2 — CID 77109962
3-(4-bromophenyl)-N-(3-hydroxycyclobutyl)prop-2-enamide (PubChem CID 77109962) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(3-hydroxycyclobutyl)prop-2-enamide.
| Compound Name | 3-(4-bromophenyl)-N-(3-hydroxycyclobutyl)prop-2-enamide |
|---|---|
| PubChem CID | 77109962 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 3-(4-bromophenyl)-N-(3-hydroxycyclobutyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Br)cc1)NC1CC(O)C1 |
| InChI | InChI=1S/C13H14BrNO2/c14-10-4-1-9(2-5-10)3-6-13(17)15-11-7-12(16)8-11/h1-6,11-12,16H,7-8H2,(H,15,17) |
| InChIKey | VIOCCRGFMNWARY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|