C26H22Br2O3 — CID 139234445
(E)-1-(4-bromophenyl)-3-[4-[6-(4-bromophenyl)-4-hydroxyoxan-2-yl]phenyl]prop-2-en-1-one (PubChem CID 139234445) has the molecular formula C26H22Br2O3 and a molecular weight of 542.27 g/mol. Its IUPAC name is (E)-1-(4-bromophenyl)-3-[4-[6-(4-bromophenyl)-4-hydroxyoxan-2-yl]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-bromophenyl)-3-[4-[6-(4-bromophenyl)-4-hydroxyoxan-2-yl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139234445 |
| Molecular Formula | C26H22Br2O3 |
| Molecular Weight | 542.27 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | (E)-1-(4-bromophenyl)-3-[4-[6-(4-bromophenyl)-4-hydroxyoxan-2-yl]phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(C2CC(O)CC(c3ccc(Br)cc3)O2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H22Br2O3/c27-21-10-6-18(7-11-21)24(30)14-3-17-1-4-19(5-2-17)25-15-23(29)16-26(31-25)20-8-12-22(28)13-9-20/h1-14,23,25-26,29H,15-16H2/b14-3+ |
| InChIKey | SCIZTTIXPLJMME-LZWSPWQCSA-N |
| XLogP | 7.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.27 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|