C13H14BrNO3S — CID 42890222
(E)-3-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 42890222) has the molecular formula C13H14BrNO3S and a molecular weight of 344.23 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 42890222 |
| Molecular Formula | C13H14BrNO3S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14BrNO3S/c14-11-4-1-10(2-5-11)3-6-13(16)15-12-7-8-19(17,18)9-12/h1-6,12H,7-9H2,(H,15,16)/b6-3+ |
| InChIKey | JBQQICXCAXLJJN-ZZXKWVIFSA-N |
| XLogP | 1.77 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|