C14H17NO3S — CID 3126681
N-(1,1-dioxothiolan-3-yl)-3-(4-methylphenyl)prop-2-enamide (PubChem CID 3126681) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3126681 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H17NO3S/c1-11-2-4-12(5-3-11)6-7-14(16)15-13-8-9-19(17,18)10-13/h2-7,13H,8-10H2,1H3,(H,15,16) |
| InChIKey | GWSNXLDLNOSAOK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|