C17H16ClNO3S2 — CID 42945686
(E)-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide (PubChem CID 42945686) has the molecular formula C17H16ClNO3S2 and a molecular weight of 381.91 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 42945686 |
| Molecular Formula | C17H16ClNO3S2 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)thiophen-2-yl]-N-(1,1-dioxothiolan-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2)s1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H16ClNO3S2/c18-13-3-1-12(2-4-13)16-7-5-15(23-16)6-8-17(20)19-14-9-10-24(21,22)11-14/h1-8,14H,9-11H2,(H,19,20)/b8-6+ |
| InChIKey | OHYHIVMNCWYOME-SOFGYWHQSA-N |
| XLogP | 3.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|