C17H18ClN3O3S2 — CID 71885493
1-[1-[5-(4-chlorophenyl)thiophen-2-yl]ethylideneamino]-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 71885493) has the molecular formula C17H18ClN3O3S2 and a molecular weight of 411.94 g/mol. Its IUPAC name is 1-[1-[5-(4-chlorophenyl)thiophen-2-yl]ethylideneamino]-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-[1-[5-(4-chlorophenyl)thiophen-2-yl]ethylideneamino]-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 71885493 |
| Molecular Formula | C17H18ClN3O3S2 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 1-[1-[5-(4-chlorophenyl)thiophen-2-yl]ethylideneamino]-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | CC(=NNC(=O)NC1CCS(=O)(=O)C1)c1ccc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C17H18ClN3O3S2/c1-11(20-21-17(22)19-14-8-9-26(23,24)10-14)15-6-7-16(25-15)12-2-4-13(18)5-3-12/h2-7,14H,8-10H2,1H3,(H2,19,21,22) |
| InChIKey | YMCVOAVRLPCHSX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|