C14H16ClNO3S — CID 110298713
(E)-3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)-2-methylprop-2-enamide (PubChem CID 110298713) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)-2-methylprop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 110298713 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(1,1-dioxothiolan-3-yl)-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1ccc(Cl)cc1)C(=O)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H16ClNO3S/c1-10(8-11-2-4-12(15)5-3-11)14(17)16-13-6-7-20(18,19)9-13/h2-5,8,13H,6-7,9H2,1H3,(H,16,17)/b10-8+ |
| InChIKey | YZIUQDLBYPXQBT-CSKARUKUSA-N |
| XLogP | 2.05 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|