C13H15ClN2O3S — CID 108908483
1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 108908483) has the molecular formula C13H15ClN2O3S and a molecular weight of 314.79 g/mol. Its IUPAC name is 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 108908483 |
| Molecular Formula | C13H15ClN2O3S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(N/C=C/c1ccc(Cl)cc1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15ClN2O3S/c14-11-3-1-10(2-4-11)5-7-15-13(17)16-12-6-8-20(18,19)9-12/h1-5,7,12H,6,8-9H2,(H2,15,16,17)/b7-5+ |
| InChIKey | ZKHSNVYZGODCBH-FNORWQNLSA-N |
| XLogP | 1.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |