C14H18N2O3S — CID 108907370
1-(1,1-dioxothiolan-3-yl)-3-[(E)-2-(4-methylphenyl)ethenyl]urea (PubChem CID 108907370) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[(E)-2-(4-methylphenyl)ethenyl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[(E)-2-(4-methylphenyl)ethenyl]urea |
|---|---|
| PubChem CID | 108907370 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[(E)-2-(4-methylphenyl)ethenyl]urea |
| SMILES | Cc1ccc(/C=C/NC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C14H18N2O3S/c1-11-2-4-12(5-3-11)6-8-15-14(17)16-13-7-9-20(18,19)10-13/h2-6,8,13H,7,9-10H2,1H3,(H2,15,16,17)/b8-6+ |
| InChIKey | BZRBNGXNAIZLKU-SOFGYWHQSA-N |
| XLogP | 1.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |