C13H18N2O4S — CID 108892990
1-(1,1-dioxothiolan-3-yl)-3-[(4-methylphenoxy)methyl]urea (PubChem CID 108892990) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[(4-methylphenoxy)methyl]urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[(4-methylphenoxy)methyl]urea |
|---|---|
| PubChem CID | 108892990 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[(4-methylphenoxy)methyl]urea |
| SMILES | Cc1ccc(OCNC(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C13H18N2O4S/c1-10-2-4-12(5-3-10)19-9-14-13(16)15-11-6-7-20(17,18)8-11/h2-5,11H,6-9H2,1H3,(H2,14,15,16) |
| InChIKey | BKSIPUQAZMPSKS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|