C19H21N3O3S — CID 129432060
1-[1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]urea (PubChem CID 129432060) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 1-[1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-[1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 129432060 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-[1-(1,2-dihydroacenaphthylen-5-yl)ethylideneamino]-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
| SMILES | CC(=NNC(=O)N[C@@H]1CCS(=O)(=O)C1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H21N3O3S/c1-12(21-22-19(23)20-15-9-10-26(24,25)11-15)16-8-7-14-6-5-13-3-2-4-17(16)18(13)14/h2-4,7-8,15H,5-6,9-11H2,1H3,(H2,20,22,23)/t15-/m1/s1 |
| InChIKey | TWVCHWZUKIUYTM-OAHLLOKOSA-N |
| XLogP | 2.15 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|