C14H18N2O3S — CID 47127977
1-(2,3-dihydro-1H-inden-1-yl)-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 47127977) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-1-yl)-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 47127977 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-1-yl)-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(NC1CCS(=O)(=O)C1)NC1CCc2ccccc21 |
| InChI | InChI=1S/C14H18N2O3S/c17-14(15-11-7-8-20(18,19)9-11)16-13-6-5-10-3-1-2-4-12(10)13/h1-4,11,13H,5-9H2,(H2,15,16,17) |
| InChIKey | LFUSNWZRDVGGHZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |