C14H18N2O4S — CID 94148995
1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[(3S)-1,1-dioxothiolan-3-yl]urea (PubChem CID 94148995) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[(3S)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[(3S)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 94148995 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[(4S)-3,4-dihydro-2H-chromen-4-yl]-3-[(3S)-1,1-dioxothiolan-3-yl]urea |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)N[C@H]1CCOc2ccccc21 |
| InChI | InChI=1S/C14H18N2O4S/c17-14(15-10-6-8-21(18,19)9-10)16-12-5-7-20-13-4-2-1-3-11(12)13/h1-4,10,12H,5-9H2,(H2,15,16,17)/t10-,12-/m0/s1 |
| InChIKey | MIPLVTJPPIPAER-JQWIXIFHSA-N |
| XLogP | 1.00 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |