C17H24N4O4S — CID 119140846
3-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 119140846) has the molecular formula C17H24N4O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is 3-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 119140846 |
| Molecular Formula | C17H24N4O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 3-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | N/C(=N\CCC(=O)NC1CCS(=O)(=O)C1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C17H24N4O4S/c18-17(21-14-6-9-25-15-4-2-1-3-13(14)15)19-8-5-16(22)20-12-7-10-26(23,24)11-12/h1-4,12,14H,5-11H2,(H,20,22)(H3,18,19,21) |
| InChIKey | UBKRUWLBCAUFLU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 122.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|