C16H23IN4O2 — CID 119140657
N-[2-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 119140657) has the molecular formula C16H23IN4O2 and a molecular weight of 430.29 g/mol. Its IUPAC name is N-[2-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 119140657 |
| Molecular Formula | C16H23IN4O2 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-[2-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | I.N/C(=N\CCNC(=O)C1CC1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H22N4O2.HI/c17-16(19-9-8-18-15(21)11-5-6-11)20-13-7-10-22-14-4-2-1-3-12(13)14;/h1-4,11,13H,5-10H2,(H,18,21)(H3,17,19,20);1H |
| InChIKey | QWAPSQWSHKBBAT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|