C16H21IN6O — CID 119140787
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(pyrazin-2-ylamino)ethyl]guanidine;hydroiodide (PubChem CID 119140787) has the molecular formula C16H21IN6O and a molecular weight of 440.29 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(pyrazin-2-ylamino)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(pyrazin-2-ylamino)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119140787 |
| Molecular Formula | C16H21IN6O |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(pyrazin-2-ylamino)ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCNc1cnccn1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C16H20N6O.HI/c17-16(21-9-8-20-15-11-18-6-7-19-15)22-13-5-10-23-14-4-2-1-3-12(13)14;/h1-4,6-7,11,13H,5,8-10H2,(H,19,20)(H3,17,21,22);1H |
| InChIKey | KXDWMQXXOCVUMV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|