C21H28BrN3O — CID 155949639
1-(3,4-dihydro-2H-chromen-4-yl)-2-(3-methyl-3-phenylbutyl)guanidine;hydrobromide (PubChem CID 155949639) has the molecular formula C21H28BrN3O and a molecular weight of 418.38 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-(3-methyl-3-phenylbutyl)guanidine;hydrobromide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-(3-methyl-3-phenylbutyl)guanidine;hydrobromide |
|---|---|
| PubChem CID | 155949639 |
| Molecular Formula | C21H28BrN3O |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-(3-methyl-3-phenylbutyl)guanidine;hydrobromide |
| SMILES | Br.CC(C)(CC/N=C(\N)NC1CCOc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O.BrH/c1-21(2,16-8-4-3-5-9-16)13-14-23-20(22)24-18-12-15-25-19-11-7-6-10-17(18)19;/h3-11,18H,12-15H2,1-2H3,(H3,22,23,24);1H |
| InChIKey | QPTNRZRUNFFFGY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|