C25H27N3O2 — CID 111821957
1-(3,4-dihydro-2H-chromen-4-yl)-2-(2-hydroxy-2,3-diphenylpropyl)guanidine (PubChem CID 111821957) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-(2-hydroxy-2,3-diphenylpropyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-(2-hydroxy-2,3-diphenylpropyl)guanidine |
|---|---|
| PubChem CID | 111821957 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-(2-hydroxy-2,3-diphenylpropyl)guanidine |
| SMILES | N/C(=N\CC(O)(Cc1ccccc1)c1ccccc1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C25H27N3O2/c26-24(28-22-15-16-30-23-14-8-7-13-21(22)23)27-18-25(29,20-11-5-2-6-12-20)17-19-9-3-1-4-10-19/h1-14,22,29H,15-18H2,(H3,26,27,28) |
| InChIKey | VLJCVSVUGPURKF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|