C20H26IN3O — CID 111598897
1-(3,4-dihydro-2H-chromen-4-yl)-2-(2-methyl-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 111598897) has the molecular formula C20H26IN3O and a molecular weight of 451.35 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-(2-methyl-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-(2-methyl-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598897 |
| Molecular Formula | C20H26IN3O |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-(2-methyl-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CC(C)(C/N=C(\N)NC1CCOc2ccccc21)c1ccccc1.I |
| InChI | InChI=1S/C20H25N3O.HI/c1-20(2,15-8-4-3-5-9-15)14-22-19(21)23-17-12-13-24-18-11-7-6-10-16(17)18;/h3-11,17H,12-14H2,1-2H3,(H3,21,22,23);1H |
| InChIKey | HIQYBISTZKIPFO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|