C18H27IN4O4S — CID 111893926
2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[(1,1-dioxothiolan-3-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111893926) has the molecular formula C18H27IN4O4S and a molecular weight of 522.41 g/mol. Its IUPAC name is 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[(1,1-dioxothiolan-3-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[(1,1-dioxothiolan-3-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111893926 |
| Molecular Formula | C18H27IN4O4S |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[(1,1-dioxothiolan-3-yl)amino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NC1CCS(=O)(=O)C1)NC1CCOc2ccccc21.I |
| InChI | InChI=1S/C18H26N4O4S.HI/c1-22(2)17(23)11-19-18(20-13-8-10-27(24,25)12-13)21-15-7-9-26-16-6-4-3-5-14(15)16;/h3-6,13,15H,7-12H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | LRDSEPSXZUWAHA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|