C22H32N4O3S — CID 110048439
2-[[(3,4-dihydro-2H-chromen-4-ylamino)-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110048439) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110048439 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-(6-oxa-2-thiaspiro[4.5]decan-9-ylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(/NC1CCOC2(CCSC2)C1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C22H32N4O3S/c1-26(2)20(27)14-23-21(24-16-7-11-29-22(13-16)9-12-30-15-22)25-18-8-10-28-19-6-4-3-5-17(18)19/h3-6,16,18H,7-15H2,1-2H3,(H2,23,24,25) |
| InChIKey | QLAWPTRPBOIOSB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|