C22H35IN4O2 — CID 111907828
2-[[(3-cyclopentylpropylamino)-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111907828) has the molecular formula C22H35IN4O2 and a molecular weight of 514.45 g/mol. Its IUPAC name is 2-[[(3-cyclopentylpropylamino)-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3-cyclopentylpropylamino)-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111907828 |
| Molecular Formula | C22H35IN4O2 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 2-[[(3-cyclopentylpropylamino)-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCC1CCCC1)NC1CCOc2ccccc21.I |
| InChI | InChI=1S/C22H34N4O2.HI/c1-26(2)21(27)16-24-22(23-14-7-10-17-8-3-4-9-17)25-19-13-15-28-20-12-6-5-11-18(19)20;/h5-6,11-12,17,19H,3-4,7-10,13-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | GAQZEAXBPQWENK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|