C24H39IN4O3 — CID 110034962
2-[[[(3-cyclopentyl-3-ethoxypropyl)amino]-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110034962) has the molecular formula C24H39IN4O3 and a molecular weight of 558.51 g/mol. Its IUPAC name is 2-[[[(3-cyclopentyl-3-ethoxypropyl)amino]-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[(3-cyclopentyl-3-ethoxypropyl)amino]-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110034962 |
| Molecular Formula | C24H39IN4O3 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 2-[[[(3-cyclopentyl-3-ethoxypropyl)amino]-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOC(CCN/C(=N\CC(=O)N(C)C)NC1CCOc2ccccc21)C1CCCC1.I |
| InChI | InChI=1S/C24H38N4O3.HI/c1-4-30-21(18-9-5-6-10-18)13-15-25-24(26-17-23(29)28(2)3)27-20-14-16-31-22-12-8-7-11-19(20)22;/h7-8,11-12,18,20-21H,4-6,9-10,13-17H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | KGZHLRYJLNQRKH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|