C24H33IN4O4 — CID 110036160
2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[2-[(4-methoxyphenyl)methoxy]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110036160) has the molecular formula C24H33IN4O4 and a molecular weight of 568.46 g/mol. Its IUPAC name is 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[2-[(4-methoxyphenyl)methoxy]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[2-[(4-methoxyphenyl)methoxy]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110036160 |
| Molecular Formula | C24H33IN4O4 |
| Molecular Weight | 568.46 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 2-[[(3,4-dihydro-2H-chromen-4-ylamino)-[2-[(4-methoxyphenyl)methoxy]ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(COCCN/C(=N\CC(=O)N(C)C)NC2CCOc3ccccc32)cc1.I |
| InChI | InChI=1S/C24H32N4O4.HI/c1-28(2)23(29)16-26-24(27-21-12-14-32-22-7-5-4-6-20(21)22)25-13-15-31-17-18-8-10-19(30-3)11-9-18;/h4-11,21H,12-17H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | BEPAWWNMFHTMJP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|