C23H33IN4O3 — CID 110037046
2-[[[2-[(4-methoxyphenyl)methoxy]ethylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110037046) has the molecular formula C23H33IN4O3 and a molecular weight of 540.45 g/mol. Its IUPAC name is 2-[[[2-[(4-methoxyphenyl)methoxy]ethylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-[(4-methoxyphenyl)methoxy]ethylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110037046 |
| Molecular Formula | C23H33IN4O3 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 2-[[[2-[(4-methoxyphenyl)methoxy]ethylamino]-(2-phenylethylamino)methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1ccc(COCCN/C(=N/CC(=O)N(C)C)NCCc2ccccc2)cc1.I |
| InChI | InChI=1S/C23H32N4O3.HI/c1-27(2)22(28)17-26-23(24-14-13-19-7-5-4-6-8-19)25-15-16-30-18-20-9-11-21(29-3)12-10-20;/h4-12H,13-18H2,1-3H3,(H2,24,25,26);1H |
| InChIKey | DZWMPIMHIQKWDK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|