C12H15ClN2O3S — CID 47133469
1-[(3-chlorophenyl)methyl]-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 47133469) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 47133469 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(NCc1cccc(Cl)c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15ClN2O3S/c13-10-3-1-2-9(6-10)7-14-12(16)15-11-4-5-19(17,18)8-11/h1-3,6,11H,4-5,7-8H2,(H2,14,15,16) |
| InChIKey | PDEFMRXAGTTZFW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |