C14H19N3O4S — CID 108518961
N-[[3-(aminomethyl)phenyl]methyl]-N'-(1,1-dioxothiolan-3-yl)oxamide (PubChem CID 108518961) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-N'-(1,1-dioxothiolan-3-yl)oxamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(1,1-dioxothiolan-3-yl)oxamide |
|---|---|
| PubChem CID | 108518961 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(1,1-dioxothiolan-3-yl)oxamide |
| SMILES | NCc1cccc(CNC(=O)C(=O)NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C14H19N3O4S/c15-7-10-2-1-3-11(6-10)8-16-13(18)14(19)17-12-4-5-22(20,21)9-12/h1-3,6,12H,4-5,7-9,15H2,(H,16,18)(H,17,19) |
| InChIKey | QNVYWFOAUPHXCA-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|