C17H25N3O2 — CID 108518943
N-[[3-(aminomethyl)phenyl]methyl]-N'-(2-methylcyclohexyl)oxamide (PubChem CID 108518943) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-N'-(2-methylcyclohexyl)oxamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(2-methylcyclohexyl)oxamide |
|---|---|
| PubChem CID | 108518943 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(2-methylcyclohexyl)oxamide |
| SMILES | CC1CCCCC1NC(=O)C(=O)NCc1cccc(CN)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-12-5-2-3-8-15(12)20-17(22)16(21)19-11-14-7-4-6-13(9-14)10-18/h4,6-7,9,12,15H,2-3,5,8,10-11,18H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | JGGLDJINMGVZAX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|