C18H26N2O2 — CID 125145050
N'-[(1S,2R)-2-methylcyclohexyl]-N-(3-phenylpropyl)oxamide (PubChem CID 125145050) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N'-[(1S,2R)-2-methylcyclohexyl]-N-(3-phenylpropyl)oxamide.
| Compound Name | N'-[(1S,2R)-2-methylcyclohexyl]-N-(3-phenylpropyl)oxamide |
|---|---|
| PubChem CID | 125145050 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N'-[(1S,2R)-2-methylcyclohexyl]-N-(3-phenylpropyl)oxamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=O)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C18H26N2O2/c1-14-8-5-6-12-16(14)20-18(22)17(21)19-13-7-11-15-9-3-2-4-10-15/h2-4,9-10,14,16H,5-8,11-13H2,1H3,(H,19,21)(H,20,22)/t14-,16+/m1/s1 |
| InChIKey | HKMHCEOXPSPDJY-ZBFHGGJFSA-N |
| XLogP | 2.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|