C16H22N4O3 — CID 108519038
N-[[3-(aminomethyl)phenyl]methyl]-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108519038) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108519038 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | NCc1cccc(CNC(=O)C(=O)NC(=O)C2CCNCC2)c1 |
| InChI | InChI=1S/C16H22N4O3/c17-9-11-2-1-3-12(8-11)10-19-15(22)16(23)20-14(21)13-4-6-18-7-5-13/h1-3,8,13,18H,4-7,9-10,17H2,(H,19,22)(H,20,21,23) |
| InChIKey | CDQIOOBVSXJLJZ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|