C15H19N3O3 — CID 108508974
N-benzyl-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108508974) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is N-benzyl-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-benzyl-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108508974 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-benzyl-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | O=C(NCc1ccccc1)C(=O)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C15H19N3O3/c19-13(12-6-8-16-9-7-12)18-15(21)14(20)17-10-11-4-2-1-3-5-11/h1-5,12,16H,6-10H2,(H,17,20)(H,18,19,21) |
| InChIKey | WNIDPQIUYBTWEF-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|