About benzylcarbamic acid;piperidine-4-carbaldehyde
benzylcarbamic acid;piperidine-4-carbaldehyde (PubChem CID 174390910) has the molecular formula C14H20N2O3
and a molecular weight of 264.32 g/mol. Its IUPAC name is benzylcarbamic acid;piperidine-4-carbaldehyde.
Molecular Properties
| Compound Name | benzylcarbamic acid;piperidine-4-carbaldehyde |
| PubChem CID | 174390910 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | benzylcarbamic acid;piperidine-4-carbaldehyde |
| SMILES | O=C(O)NCc1ccccc1.O=CC1CCNCC1 |
| InChI | InChI=1S/C8H9NO2.C6H11NO/c10-8(11)9-6-7-4-2-1-3-5-7;8-5-6-1-3-7-4-2-6/h1-5,9H,6H2,(H,10,11);5-7H,1-4H2 |
| InChIKey | RXZBBLTYFXYPIH-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzylcarbamic acid;piperidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylcarbamic acid;piperidine-4-carbaldehyde?
The IUPAC name of benzylcarbamic acid;piperidine-4-carbaldehyde (CID 174390910) is benzylcarbamic acid;piperidine-4-carbaldehyde.
What is the SMILES notation for benzylcarbamic acid;piperidine-4-carbaldehyde?
The canonical SMILES for benzylcarbamic acid;piperidine-4-carbaldehyde is O=C(O)NCc1ccccc1.O=CC1CCNCC1.
What is the InChIKey of benzylcarbamic acid;piperidine-4-carbaldehyde?
The InChIKey is RXZBBLTYFXYPIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C6H11NO/c10-8(11)9-6-7-4-2-1-3-5-7;8-5-6-1-3-7-4-2-6/h1-5,9H,6H2,(H,10,11);5-7H,1-4H2.
What are the key properties of benzylcarbamic acid;piperidine-4-carbaldehyde?
benzylcarbamic acid;piperidine-4-carbaldehyde has a molecular weight of 264.32 g/mol, XLogP of 1.64, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzylcarbamic acid;piperidine-4-carbaldehyde is sourced from PubChem (CID 174390910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).