C16H24N2O2 — CID 68520941
[3-[(cyclohexylmethylamino)methyl]phenyl]methylcarbamic acid (PubChem CID 68520941) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is [3-[(cyclohexylmethylamino)methyl]phenyl]methylcarbamic acid.
| Compound Name | [3-[(cyclohexylmethylamino)methyl]phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 68520941 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | [3-[(cyclohexylmethylamino)methyl]phenyl]methylcarbamic acid |
| SMILES | O=C(O)NCc1cccc(CNCC2CCCCC2)c1 |
| InChI | InChI=1S/C16H24N2O2/c19-16(20)18-12-15-8-4-7-14(9-15)11-17-10-13-5-2-1-3-6-13/h4,7-9,13,17-18H,1-3,5-6,10-12H2,(H,19,20) |
| InChIKey | MYMSIZRPTAVTFD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |