C14H20BrN — CID 43215546
N-[(3-bromophenyl)methyl]-1-cyclohexylmethanamine (PubChem CID 43215546) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1-cyclohexylmethanamine.
| Compound Name | N-[(3-bromophenyl)methyl]-1-cyclohexylmethanamine |
|---|---|
| PubChem CID | 43215546 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1-cyclohexylmethanamine |
| SMILES | Brc1cccc(CNCC2CCCCC2)c1 |
| InChI | InChI=1S/C14H20BrN/c15-14-8-4-7-13(9-14)11-16-10-12-5-2-1-3-6-12/h4,7-9,12,16H,1-3,5-6,10-11H2 |
| InChIKey | DSGCLZIXITUTHI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |