C12H16BrN — CID 43298546
N-[(3-bromophenyl)methyl]-1-cyclobutylmethanamine (PubChem CID 43298546) has the molecular formula C12H16BrN and a molecular weight of 254.17 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-1-cyclobutylmethanamine.
| Compound Name | N-[(3-bromophenyl)methyl]-1-cyclobutylmethanamine |
|---|---|
| PubChem CID | 43298546 |
| Molecular Formula | C12H16BrN |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-1-cyclobutylmethanamine |
| SMILES | Brc1cccc(CNCC2CCC2)c1 |
| InChI | InChI=1S/C12H16BrN/c13-12-6-2-5-11(7-12)9-14-8-10-3-1-4-10/h2,5-7,10,14H,1,3-4,8-9H2 |
| InChIKey | DLGXLYTVYQMZDG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |