C14H21N3O4 — CID 154905170
1-benzyl-3-[(3S,4R)-4-hydroxypiperidin-3-yl]urea;formic acid (PubChem CID 154905170) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 1-benzyl-3-[(3S,4R)-4-hydroxypiperidin-3-yl]urea;formic acid.
| Compound Name | 1-benzyl-3-[(3S,4R)-4-hydroxypiperidin-3-yl]urea;formic acid |
|---|---|
| PubChem CID | 154905170 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-benzyl-3-[(3S,4R)-4-hydroxypiperidin-3-yl]urea;formic acid |
| SMILES | O=C(NCc1ccccc1)N[C@H]1CNCC[C@H]1O.O=CO |
| InChI | InChI=1S/C13H19N3O2.CH2O2/c17-12-6-7-14-9-11(12)16-13(18)15-8-10-4-2-1-3-5-10;2-1-3/h1-5,11-12,14,17H,6-9H2,(H2,15,16,18);1H,(H,2,3)/t11-,12+;/m0./s1 |
| InChIKey | IXSMZNKYIFJCOL-ZVWHLABXSA-N |
| XLogP | -0.09 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|