C11H16N2O3 — CID 175901151
benzylcarbamic acid;N,N-dimethylformamide (PubChem CID 175901151) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is benzylcarbamic acid;N,N-dimethylformamide.
| Compound Name | benzylcarbamic acid;N,N-dimethylformamide |
|---|---|
| PubChem CID | 175901151 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | benzylcarbamic acid;N,N-dimethylformamide |
| SMILES | CN(C)C=O.O=C(O)NCc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C3H7NO/c10-8(11)9-6-7-4-2-1-3-5-7;1-4(2)3-5/h1-5,9H,6H2,(H,10,11);3H,1-2H3 |
| InChIKey | TWSFQLDUGDJIFY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|