About N-benzylundecanamide
N-benzylundecanamide (PubChem CID 5078198) has the molecular formula C18H29NO
and a molecular weight of 275.44 g/mol. Its IUPAC name is N-benzylundecanamide.
Molecular Properties
| Compound Name | N-benzylundecanamide |
| PubChem CID | 5078198 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N-benzylundecanamide |
| SMILES | CCCCCCCCCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C18H29NO/c1-2-3-4-5-6-7-8-12-15-18(20)19-16-17-13-10-9-11-14-17/h9-11,13-14H,2-8,12,15-16H2,1H3,(H,19,20) |
| InChIKey | ZOFBRFJQBJRFGN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzylundecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylundecanamide?
The IUPAC name of N-benzylundecanamide (CID 5078198) is N-benzylundecanamide.
What is the SMILES notation for N-benzylundecanamide?
The canonical SMILES for N-benzylundecanamide is CCCCCCCCCCC(=O)NCc1ccccc1.
What is the InChIKey of N-benzylundecanamide?
The InChIKey is ZOFBRFJQBJRFGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO/c1-2-3-4-5-6-7-8-12-15-18(20)19-16-17-13-10-9-11-14-17/h9-11,13-14H,2-8,12,15-16H2,1H3,(H,19,20).
What are the key properties of N-benzylundecanamide?
N-benzylundecanamide has a molecular weight of 275.44 g/mol, XLogP of 4.83, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylundecanamide is sourced from PubChem (CID 5078198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).