C25H39NO2 — CID 174776077
(E)-N-benzyl-9-oxooctadec-12-enamide (PubChem CID 174776077) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is (E)-N-benzyl-9-oxooctadec-12-enamide.
| Compound Name | (E)-N-benzyl-9-oxooctadec-12-enamide |
|---|---|
| PubChem CID | 174776077 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | (E)-N-benzyl-9-oxooctadec-12-enamide |
| SMILES | CCCCC/C=C/CCC(=O)CCCCCCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H39NO2/c1-2-3-4-5-6-8-14-19-24(27)20-15-9-7-10-16-21-25(28)26-22-23-17-12-11-13-18-23/h6,8,11-13,17-18H,2-5,7,9-10,14-16,19-22H2,1H3,(H,26,28)/b8-6+ |
| InChIKey | NAPLCBOQGUNIRA-SOFGYWHQSA-N |
| XLogP | 6.52 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|