C27H44ClNO — CID 174388614
(11Z)-2-(benzylamino)icosa-1,11-dien-3-one;hydrochloride (PubChem CID 174388614) has the molecular formula C27H44ClNO and a molecular weight of 434.11 g/mol. Its IUPAC name is (11Z)-2-(benzylamino)icosa-1,11-dien-3-one;hydrochloride.
| Compound Name | (11Z)-2-(benzylamino)icosa-1,11-dien-3-one;hydrochloride |
|---|---|
| PubChem CID | 174388614 |
| Molecular Formula | C27H44ClNO |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | (11Z)-2-(benzylamino)icosa-1,11-dien-3-one;hydrochloride |
| SMILES | C=C(NCc1ccccc1)C(=O)CCCCCCC/C=C\CCCCCCCC.Cl |
| InChI | InChI=1S/C27H43NO.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-27(29)25(2)28-24-26-21-18-17-19-22-26;/h10-11,17-19,21-22,28H,2-9,12-16,20,23-24H2,1H3;1H/b11-10-; |
| InChIKey | YGNQHOQEODLERH-GMFCBQQYSA-N |
| XLogP | 8.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|